CAS 927822-86-4 appears in our catalog under these names: N,N'-(Dithiodi-2,1-ethanediyl)bis(2,5-dichloro-benzenesulfonamide, KC7F2/ 99.11% (existing batch purity), KC7F2, KC7F2 98%, HIF-1╬▒ Translation Inhibitor 1PC X 25MG. Offered by: TRC, TargetMol, GLPBio, Ambeed, Sigma-Aldrich. Available pack sizes: 250mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
2,5-dichloro-N-[2-[2-[(2,5-dichlorophenyl)sulfonylamino]ethyldisulfanyl]ethyl]benzenesulfonamide (CAS 927822-86-4) is a chemical compound with the molecular formula C16H16Cl4N2O4S4 and a molecular weight of 570.4 g/mol. IUPAC name: 2,5-dichloro-N-[2-[2-[(2,5-dichlorophenyl)sulfonylamino]ethyldisulfanyl]ethyl]benzenesulfonamide. InChIKey: REQLACDIZMLXIC-UHFFFAOYSA-N.
| Molecular formula | C16H16Cl4N2O4S4 |
|---|---|
| Molecular weight | 570.4 g/mol |
| IUPAC name | 2,5-dichloro-N-[2-[2-[(2,5-dichlorophenyl)sulfonylamino]ethyldisulfanyl]ethyl]benzenesulfonamide |
| InChIKey | REQLACDIZMLXIC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)S(=O)(=O)NCCSSCCNS(=O)(=O)C2=C(C=CC(=C2)Cl)Cl)Cl |
Computed by PubChem (NCBI)