Products 1905481-36-8
CAS 1905481-36-8 appears in our catalog under these names: KDM5A-IN-1/ 99.8% (existing batch purity), KDM5A–IN–1, KDM5A-IN-1, KDM5A-IN-1, 99.95%, KDM5A-IN-1 (Standard). Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 100mg, 10mM (in 1ml dmso), 5mg, 50mg, 25mg, 50 mg.
N-[(3R)-1-(5-propan-2-yl-1H-pyrazole-3-carbonyl)pyrrolidin-3-yl]cyclopropanecarboxamide (CAS 1905481-36-8) is a chemical compound with the molecular formula C15H22N4O2 and a molecular weight of 290.36 g/mol. IUPAC name: N-[(3R)-1-(5-propan-2-yl-1H-pyrazole-3-carbonyl)pyrrolidin-3-yl]cyclopropanecarboxamide. InChIKey: CXEXTVGTDZRKJS-LLVKDONJSA-N.
| Molecular formula | C15H22N4O2 |
|---|---|
| Molecular weight | 290.36 g/mol |
| IUPAC name | N-[(3R)-1-(5-propan-2-yl-1H-pyrazole-3-carbonyl)pyrrolidin-3-yl]cyclopropanecarboxamide |
| InChIKey | CXEXTVGTDZRKJS-LLVKDONJSA-N |
| SMILES | CC(C)C1=CC(=NN1)C(=O)N2CC[C@H](C2)NC(=O)C3CC3 |
Computed by PubChem (NCBI)
Synonyms:
orb1707141