CAS 330676-02-3 appears in our catalog under these names: Kh 7, KH7/ 99.56% (existing batch purity), KH 7, (E)-2-(1H-Benzo(d)imidazol-2-ylthio)-N'-(5-bromo-2-hydroxybenzylidene)propanehydrazide, KH7 99%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 100mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 0,5g.
2-(1H-benzimidazol-2-ylsulfanyl)-N-[(5-bromo-2-hydroxyphenyl)methylideneamino]propanamide (CAS 330676-02-3) is a chemical compound with the molecular formula C17H15BrN4O2S and a molecular weight of 419.3 g/mol. IUPAC name: 2-(1H-benzimidazol-2-ylsulfanyl)-N-[(5-bromo-2-hydroxyphenyl)methylideneamino]propanamide. InChIKey: WILMXUAKQKGGCC-UHFFFAOYSA-N.
| Molecular formula | C17H15BrN4O2S |
|---|---|
| Molecular weight | 419.3 g/mol |
| IUPAC name | 2-(1H-benzimidazol-2-ylsulfanyl)-N-[(5-bromo-2-hydroxyphenyl)methylideneamino]propanamide |
| InChIKey | WILMXUAKQKGGCC-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NN=CC1=C(C=CC(=C1)Br)O)SC2=NC3=CC=CC=C3N2 |
Computed by PubChem (NCBI)