CAS 2600559-20-2 appears in our catalog under these names: KIF18A–IN–2, KIF18A-IN-2, KIF18A-IN-2, 98.49%, KIF18A-IN-2/ 99.05% (existing batch purity). Offered by: GLPBio, Chemat, MedChemExpress, TargetMol. Available pack sizes: 10mg, 5mg, 1mg, 25mg, 50mg, 100mg, 200mg, 50 mg.
2-(6-azaspiro[2.5]octan-6-yl)-N-[3-(tert-butylsulfamoyl)phenyl]-4-(methanesulfonamido)benzamide (CAS 2600559-20-2) is a chemical compound with the molecular formula C25H34N4O5S2 and a molecular weight of 534.7 g/mol. IUPAC name: 2-(6-azaspiro[2.5]octan-6-yl)-N-[3-(tert-butylsulfamoyl)phenyl]-4-(methanesulfonamido)benzamide. InChIKey: BSVSZERUDCKTME-UHFFFAOYSA-N.
| Molecular formula | C25H34N4O5S2 |
|---|---|
| Molecular weight | 534.7 g/mol |
| IUPAC name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[3-(tert-butylsulfamoyl)phenyl]-4-(methanesulfonamido)benzamide |
| InChIKey | BSVSZERUDCKTME-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NS(=O)(=O)C1=CC=CC(=C1)NC(=O)C2=C(C=C(C=C2)NS(=O)(=O)C)N3CCC4(CC4)CC3 |
Computed by PubChem (NCBI)