CAS 1021497-97-1 appears in our catalog under these names: KR-33493/ 99.71% (existing batch purity), KR–33493, KR- 33494, 4-[[2-[(4-Bromophenyl)thio]acetyl]amino]-1-(2-phenylethyl)-1H-pyrazole-3-carboxylic acid, KR-33493, 99.94%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 1g.
4-[[2-(4-bromophenyl)sulfanylacetyl]amino]-1-(2-phenylethyl)pyrazole-3-carboxylic acid (CAS 1021497-97-1) is a chemical compound with the molecular formula C20H18BrN3O3S and a molecular weight of 460.3 g/mol. IUPAC name: 4-[[2-(4-bromophenyl)sulfanylacetyl]amino]-1-(2-phenylethyl)pyrazole-3-carboxylic acid. InChIKey: ZRLJEHIUGYTTSZ-UHFFFAOYSA-N.
| Molecular formula | C20H18BrN3O3S |
|---|---|
| Molecular weight | 460.3 g/mol |
| IUPAC name | 4-[[2-(4-bromophenyl)sulfanylacetyl]amino]-1-(2-phenylethyl)pyrazole-3-carboxylic acid |
| InChIKey | ZRLJEHIUGYTTSZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCN2C=C(C(=N2)C(=O)O)NC(=O)CSC3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)