cas: 587871-26-9 — see every product listed under this CAS number, including other names
KU-55933 96% (CAS 587871-26-9) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A528135-1mg |
| cas | 587871-26-9 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 159.00 Pln | |
| Ambeed | 5mg | 253.56 Pln | |
| Ambeed | 10mg | 320.31 Pln | |
| Ambeed | 50mg | 782.00 Pln | |
| Ambeed | 100mg | 1288.19 Pln | |
| Ambeed | 250mg | 2139.25 Pln | |
| Ambeed | 1g | 7484.81 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A528135 |
2-morpholin-4-yl-6-thianthren-1-ylpyran-4-one (CAS 587871-26-9) is a chemical compound with the molecular formula C21H17NO3S2 and a molecular weight of 395.5 g/mol. IUPAC name: 2-morpholin-4-yl-6-thianthren-1-ylpyran-4-one. InChIKey: XRKYMMUGXMWDAO-UHFFFAOYSA-N.
| Molecular formula | C21H17NO3S2 |
|---|---|
| Molecular weight | 395.5 g/mol |
| IUPAC name | 2-morpholin-4-yl-6-thianthren-1-ylpyran-4-one |
| InChIKey | XRKYMMUGXMWDAO-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC(=O)C=C(O2)C3=C4C(=CC=C3)SC5=CC=CC=C5S4 |
Computed by PubChem (NCBI)