CAS 587871-26-9 appears in our catalog under these names: KU-55933, KU 55933, >95% (HPLC), KU-55933/ 99.8% (existing batch purity), KU 55933, KU 55933. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 50mg, 5mg, 25mg, 100mg, 10mM (in 1ml dmso), 1mg.
2-morpholin-4-yl-6-thianthren-1-ylpyran-4-one (CAS 587871-26-9) is a chemical compound with the molecular formula C21H17NO3S2 and a molecular weight of 395.5 g/mol. IUPAC name: 2-morpholin-4-yl-6-thianthren-1-ylpyran-4-one. InChIKey: XRKYMMUGXMWDAO-UHFFFAOYSA-N.
| Molecular formula | C21H17NO3S2 |
|---|---|
| Molecular weight | 395.5 g/mol |
| IUPAC name | 2-morpholin-4-yl-6-thianthren-1-ylpyran-4-one |
| InChIKey | XRKYMMUGXMWDAO-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC(=O)C=C(O2)C3=C4C(=CC=C3)SC5=CC=CC=C5S4 |
Computed by PubChem (NCBI)