CAS 518058-84-9 appears in our catalog under these names: 5-Fluoro-n-(3-hydroxybenzyl)-1h-indole-2-carboxamide, 95%, KX1-004/ 99.42% (existing batch purity), KX1–004, Kx1-004, 97%, 97%, KX1-004, 99.75%. Offered by: Combi-blocks, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg.
5-fluoro-N-[(3-hydroxyphenyl)methyl]-1H-indole-2-carboxamide (CAS 518058-84-9) is a chemical compound with the molecular formula C16H13FN2O2 and a molecular weight of 284.28 g/mol. IUPAC name: 5-fluoro-N-[(3-hydroxyphenyl)methyl]-1H-indole-2-carboxamide. InChIKey: TUIHIKXCMCXXJG-UHFFFAOYSA-N.
| Molecular formula | C16H13FN2O2 |
|---|---|
| Molecular weight | 284.28 g/mol |
| IUPAC name | 5-fluoro-N-[(3-hydroxyphenyl)methyl]-1H-indole-2-carboxamide |
| InChIKey | TUIHIKXCMCXXJG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)CNC(=O)C2=CC3=C(N2)C=CC(=C3)F |
Computed by PubChem (NCBI)