CAS 1621673-53-7 appears in our catalog under these names: KY-226/ 99.4% (existing batch purity), KY–226, KY-226, KY-226 98%, KY-226, 98%, 98%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 250mg.
N-hexylsulfonyl-4-[(4-phenylphenyl)methylsulfanylmethyl]benzamide (CAS 1621673-53-7) is a chemical compound with the molecular formula C27H31NO3S2 and a molecular weight of 481.7 g/mol. IUPAC name: N-hexylsulfonyl-4-[(4-phenylphenyl)methylsulfanylmethyl]benzamide. InChIKey: MKXMABKUVSOEJF-UHFFFAOYSA-N.
| Molecular formula | C27H31NO3S2 |
|---|---|
| Molecular weight | 481.7 g/mol |
| IUPAC name | N-hexylsulfonyl-4-[(4-phenylphenyl)methylsulfanylmethyl]benzamide |
| InChIKey | MKXMABKUVSOEJF-UHFFFAOYSA-N |
| SMILES | CCCCCCS(=O)(=O)NC(=O)C1=CC=C(C=C1)CSCC2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)