CAS 454453-49-7 appears in our catalog under these names: 2-(2,6-Dinitro-4-(trifluoromethyl)phenyl)-N-(4-fluorophenyl)hydrazinecarbothioamide, Kobe2602/ 99.24% (existing batch purity), kobe2602, Kobe2602, 98%, 98%, Kobe2602, 98.20%. Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1g, 25mg, 50mg, 100mg, 1mg, 10mM (in 1ml dmso), 5mg, 10mM/1mL.
1-[2,6-dinitro-4-(trifluoromethyl)anilino]-3-(4-fluorophenyl)thiourea (CAS 454453-49-7) is a chemical compound with the molecular formula C14H9F4N5O4S and a molecular weight of 419.31 g/mol. IUPAC name: 1-[2,6-dinitro-4-(trifluoromethyl)anilino]-3-(4-fluorophenyl)thiourea. InChIKey: NNPBSITXCGPXJC-UHFFFAOYSA-N.
| Molecular formula | C14H9F4N5O4S |
|---|---|
| Molecular weight | 419.31 g/mol |
| IUPAC name | 1-[2,6-dinitro-4-(trifluoromethyl)anilino]-3-(4-fluorophenyl)thiourea |
| InChIKey | NNPBSITXCGPXJC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=S)NNC2=C(C=C(C=C2[N+](=O)[O-])C(F)(F)F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)