CAS 151488-11-8 appears in our catalog under these names: L-162,313/ 98.31% (existing batch purity), L-162,313 97%, L-162,313, L-162313, 98.51%. Offered by: TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 10 mg.
Butyl N-[3-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-5-(2-methylpropyl)thiophen-2-yl]sulfonylcarbamate (CAS 151488-11-8) is a chemical compound with the molecular formula C30H38N4O4S2 and a molecular weight of 582.8 g/mol. IUPAC name: butyl N-[3-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-5-(2-methylpropyl)thiophen-2-yl]sulfonylcarbamate. InChIKey: RINPELQWLUGERM-UHFFFAOYSA-N.
| Molecular formula | C30H38N4O4S2 |
|---|---|
| Molecular weight | 582.8 g/mol |
| IUPAC name | butyl N-[3-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-5-(2-methylpropyl)thiophen-2-yl]sulfonylcarbamate |
| InChIKey | RINPELQWLUGERM-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)NS(=O)(=O)C1=C(C=C(S1)CC(C)C)C2=CC=C(C=C2)CN3C(=NC4=C3N=C(C=C4C)C)CC |
Computed by PubChem (NCBI)