cas: 223593-04-2 — see every product listed under this CAS number, including other names
L-4-Carbamoylphenylalanine, 97%, 97% (CAS 223593-04-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117YQ3-100mg |
| cas | 223593-04-2 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 342.80 Pln | |
| Chemat | 250mg | 621.20 Pln | |
| Chemat | 500mg | 899.60 Pln | |
| Chemat | 1g | 1456.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-amino-3-(4-carbamoylphenyl)propanoic acid (CAS 223593-04-2) is a chemical compound with the molecular formula C10H12N2O3 and a molecular weight of 208.21 g/mol. IUPAC name: (2S)-2-amino-3-(4-carbamoylphenyl)propanoic acid. InChIKey: OZVAXCWACWDNIQ-QMMMGPOBSA-N.
| Molecular formula | C10H12N2O3 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-carbamoylphenyl)propanoic acid |
| InChIKey | OZVAXCWACWDNIQ-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](C(=O)O)N)C(=O)N |
Computed by PubChem (NCBI)