CAS 878160-17-9 appears in our catalog under these names: 6-Amino-7-methoxy-4-methyl-2h-benzo[b][1,4]oxazin-3(4h)-one, 95%, 6–Amino–7–Methoxy–4–Methyl–2H–Benzo(B)(1,4)Oxazin–3(4H)–One, 6-Amino-7-methoxy-4-methyl-2H-1,4-benzoxazin-3(4H)-one, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 10mg, 50mg.
6-amino-7-methoxy-4-methyl-1,4-benzoxazin-3-one (CAS 878160-17-9) is a chemical compound with the molecular formula C10H12N2O3 and a molecular weight of 208.21 g/mol. IUPAC name: 6-amino-7-methoxy-4-methyl-1,4-benzoxazin-3-one. InChIKey: VMLABVHRKWDMOF-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O3 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 6-amino-7-methoxy-4-methyl-1,4-benzoxazin-3-one |
| InChIKey | VMLABVHRKWDMOF-UHFFFAOYSA-N |
| SMILES | CN1C(=O)COC2=C1C=C(C(=C2)OC)N |
Computed by PubChem (NCBI)