cas: 6382-01-0 — see every product listed under this CAS number, including other names
L-Glutamic acid, potassium salt, hydrate (1:1:1), 97%, 97% (CAS 6382-01-0) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114R0Z-1kg |
| cas | 6382-01-0 |
| size | 1kg |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 611.60 Pln | |
| Chemat | 25g | 98.00 Pln | |
| Chemat | 100g | 160.40 Pln | |
| Chemat | 500g | 384.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Potassium;(4S)-4-amino-5-hydroxy-5-oxopentanoate;hydrate (CAS 6382-01-0) is a chemical compound with the molecular formula C5H10KNO5 and a molecular weight of 203.23 g/mol. IUPAC name: potassium;(4S)-4-amino-5-hydroxy-5-oxopentanoate;hydrate. InChIKey: XIBUKSQTWSKJMQ-QTNFYWBSSA-M.
| Molecular formula | C5H10KNO5 |
|---|---|
| Molecular weight | 203.23 g/mol |
| IUPAC name | potassium;(4S)-4-amino-5-hydroxy-5-oxopentanoate;hydrate |
| InChIKey | XIBUKSQTWSKJMQ-QTNFYWBSSA-M |
| SMILES | C(CC(=O)[O-])[C@@H](C(=O)O)N.O.[K+] |
Computed by PubChem (NCBI)