CAS 19473-49-5 appears in our catalog under these names: L–Glutamic acid monopotassium salt, Monopotassium glutamate, Monopotassium L-glutamate, 98%, 98%, L-Glutamic acid (monopotassium salt), 98.0%, Potassium (S)-4-amino-4-carboxybutanoate. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100g, 1g, 25g, 500mg, 5g, 5mg, 10mg, 25mg.
Potassium;(4S)-4-amino-5-hydroxy-5-oxopentanoate;hydrate (CAS 19473-49-5) is a chemical compound with the molecular formula C5H10KNO5 and a molecular weight of 203.23 g/mol. IUPAC name: potassium;(4S)-4-amino-5-hydroxy-5-oxopentanoate;hydrate. InChIKey: XIBUKSQTWSKJMQ-QTNFYWBSSA-M.
| Molecular formula | C5H10KNO5 |
|---|---|
| Molecular weight | 203.23 g/mol |
| IUPAC name | potassium;(4S)-4-amino-5-hydroxy-5-oxopentanoate;hydrate |
| InChIKey | XIBUKSQTWSKJMQ-QTNFYWBSSA-M |
| SMILES | C(CC(=O)[O-])[C@@H](C(=O)O)N.O.[K+] |
Computed by PubChem (NCBI)