cas: 15383-56-9 — see every product listed under this CAS number, including other names
L-Proline sodiuM salt, 95%, 95% (CAS 15383-56-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AQGK-100mg |
| cas | 15383-56-9 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 208.40 Pln | |
| Chemat | 10g | 323.60 Pln | |
| Chemat | 25g | 635.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Sodium (2S)-pyrrolidine-2-carboxylate (CAS 15383-56-9) is a chemical compound with the molecular formula C5H8NNaO2 and a molecular weight of 137.11 g/mol. IUPAC name: sodium (2S)-pyrrolidine-2-carboxylate. InChIKey: CUTQWXGMRNLXQC-WCCKRBBISA-M.
| Molecular formula | C5H8NNaO2 |
|---|---|
| Molecular weight | 137.11 g/mol |
| IUPAC name | sodium (2S)-pyrrolidine-2-carboxylate |
| InChIKey | CUTQWXGMRNLXQC-WCCKRBBISA-M |
| SMILES | C1C[C@H](NC1)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)