CAS 15383-56-9 appears in our catalog under these names: L-Proline sodium salt, 97%, H-Pro-OH(Sodium) 97%, L-Proline sodiuM salt, 95%, 95%, Sodium (S)-pyrrolidine-2-carboxylate, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100g, 100mg, 250mg, 10g.
Sodium (2S)-pyrrolidine-2-carboxylate (CAS 15383-56-9) is a chemical compound with the molecular formula C5H8NNaO2 and a molecular weight of 137.11 g/mol. IUPAC name: sodium (2S)-pyrrolidine-2-carboxylate. InChIKey: CUTQWXGMRNLXQC-WCCKRBBISA-M.
| Molecular formula | C5H8NNaO2 |
|---|---|
| Molecular weight | 137.11 g/mol |
| IUPAC name | sodium (2S)-pyrrolidine-2-carboxylate |
| InChIKey | CUTQWXGMRNLXQC-WCCKRBBISA-M |
| SMILES | C1C[C@H](NC1)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)