CAS 28874-51-3 appears in our catalog under these names: L-Pyroglutamic acid sodium, 97%, Sodium L-Pyroglutamate (Technical Grade), Sodium L–pyroglutamate, Sodium pyroglutamate, L-Pyroglutamic acid sodium 50% in H2O. Offered by: AmBeed, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 500g, 25g, 1g, 500mg, 5g, 2kg, 1kg, 5kg.
Sodium (2S)-5-oxopyrrolidine-2-carboxylate (CAS 28874-51-3) is a chemical compound with the molecular formula C5H6NNaO3 and a molecular weight of 151.10 g/mol. IUPAC name: sodium (2S)-5-oxopyrrolidine-2-carboxylate. InChIKey: CRPCXAMJWCDHFM-DFWYDOINSA-M.
| Molecular formula | C5H6NNaO3 |
|---|---|
| Molecular weight | 151.10 g/mol |
| IUPAC name | sodium (2S)-5-oxopyrrolidine-2-carboxylate |
| InChIKey | CRPCXAMJWCDHFM-DFWYDOINSA-M |
| SMILES | C1CC(=O)N[C@@H]1C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)