CAS 64047-13-8 is the registry number for 5,5-Dimethyl-3-sodio-1,3-oxazolidine-2,4-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Sodium 5,5-dimethyl-1,3-oxazolidin-3-ide-2,4-dione (CAS 64047-13-8) is a chemical compound with the molecular formula C5H6NNaO3 and a molecular weight of 151.10 g/mol. IUPAC name: sodium 5,5-dimethyl-1,3-oxazolidin-3-ide-2,4-dione. InChIKey: OWGHQPIPPHGSGP-UHFFFAOYSA-M.
| Molecular formula | C5H6NNaO3 |
|---|---|
| Molecular weight | 151.10 g/mol |
| IUPAC name | sodium 5,5-dimethyl-1,3-oxazolidin-3-ide-2,4-dione |
| InChIKey | OWGHQPIPPHGSGP-UHFFFAOYSA-M |
| SMILES | CC1(C(=O)[N-]C(=O)O1)C.[Na+] |
Computed by PubChem (NCBI)