cas: 10148-71-7 — see every product listed under this CAS number, including other names
L-Threo-Hydroxyleucine, 98% (CAS 10148-71-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F303135-100MG |
| cas | 10148-71-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 2189.87 Pln | |
| Fluorochem | 250mg | 3231.17 Pln | |
| Fluorochem | 1g | 7635.87 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2S,3R)-2-amino-3-hydroxy-4-methylpentanoic acid (CAS 10148-71-7) is a chemical compound with the molecular formula C6H13NO3 and a molecular weight of 147.17 g/mol. IUPAC name: (2S,3R)-2-amino-3-hydroxy-4-methylpentanoic acid. InChIKey: ZAYJDMWJYCTABM-CRCLSJGQSA-N.
| Molecular formula | C6H13NO3 |
|---|---|
| Molecular weight | 147.17 g/mol |
| IUPAC name | (2S,3R)-2-amino-3-hydroxy-4-methylpentanoic acid |
| InChIKey | ZAYJDMWJYCTABM-CRCLSJGQSA-N |
| SMILES | CC(C)[C@H]([C@@H](C(=O)O)N)O |
Computed by PubChem (NCBI)