cas: 1343476-44-7 — see every product listed under this CAS number, including other names
L-Valyl-N-[4-(hydroxymethyl)phenyl]-L-alaninamide, 98%, 98% (CAS 1343476-44-7) is a chemical reagent available from Chemat. Available pack sizes: 50g, 100g, 250g, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12E284-50g |
| cas | 1343476-44-7 |
| size | 50g |
| availability | 250g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 3746.00 Pln | |
| Chemat | 100g | 5958.80 Pln | |
| Chemat | 250g | 11128.40 Pln | |
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 213.20 Pln | |
| Chemat | 1g | 438.80 Pln | |
| Chemat | 5g | 1062.80 Pln | |
| Chemat | 10g | 1442.00 Pln | |
| Chemat | 25g | 2474.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-amino-N-[(2S)-1-[4-(hydroxymethyl)anilino]-1-oxopropan-2-yl]-3-methylbutanamide (CAS 1343476-44-7) is a chemical compound with the molecular formula C15H23N3O3 and a molecular weight of 293.36 g/mol. IUPAC name: (2S)-2-amino-N-[(2S)-1-[4-(hydroxymethyl)anilino]-1-oxopropan-2-yl]-3-methylbutanamide. InChIKey: NNWYWNRCBPYLML-GWCFXTLKSA-N.
| Molecular formula | C15H23N3O3 |
|---|---|
| Molecular weight | 293.36 g/mol |
| IUPAC name | (2S)-2-amino-N-[(2S)-1-[4-(hydroxymethyl)anilino]-1-oxopropan-2-yl]-3-methylbutanamide |
| InChIKey | NNWYWNRCBPYLML-GWCFXTLKSA-N |
| SMILES | C[C@@H](C(=O)NC1=CC=C(C=C1)CO)NC(=O)[C@H](C(C)C)N |
Computed by PubChem (NCBI)