CAS 1186311-23-8 is the registry number for [2-(2,2-Dimethyl-propionylamino)-pyridin-3-yl]-carbamic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl N-[2-(2,2-dimethylpropanoylamino)-3-pyridinyl]carbamate (CAS 1186311-23-8) is a chemical compound with the molecular formula C15H23N3O3 and a molecular weight of 293.36 g/mol. IUPAC name: tert-butyl N-[2-(2,2-dimethylpropanoylamino)-3-pyridinyl]carbamate. InChIKey: XYKDKZCRXCENOO-UHFFFAOYSA-N.
| Molecular formula | C15H23N3O3 |
|---|---|
| Molecular weight | 293.36 g/mol |
| IUPAC name | tert-butyl N-[2-(2,2-dimethylpropanoylamino)-3-pyridinyl]carbamate |
| InChIKey | XYKDKZCRXCENOO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(C=CC=N1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)