Products 1186311-23-8

CAS 1186311-23-8 is the registry number for [2-(2,2-Dimethyl-propionylamino)-pyridin-3-yl]-carbamic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-[2-(2,2-dimethylpropanoylamino)-3-pyridinyl]carbamate (CAS 1186311-23-8) is a chemical compound with the molecular formula C15H23N3O3 and a molecular weight of 293.36 g/mol. IUPAC name: tert-butyl N-[2-(2,2-dimethylpropanoylamino)-3-pyridinyl]carbamate. InChIKey: XYKDKZCRXCENOO-UHFFFAOYSA-N.

Identity
Molecular formulaC15H23N3O3
Molecular weight293.36 g/mol
IUPAC nametert-butyl N-[2-(2,2-dimethylpropanoylamino)-3-pyridinyl]carbamate
InChIKeyXYKDKZCRXCENOO-UHFFFAOYSA-N
SMILESCC(C)(C)C(=O)NC1=C(C=CC=N1)NC(=O)OC(C)(C)C

Computed by PubChem (NCBI)