CAS 951612-19-4 appears in our catalog under these names: 4-(1-(3-Chlorophenyl)-1H-1,2,3-triazole-4-carbonyl)thiomorpholine, L524-0366, 95+%, L524–0366, L524-0366/ 96.31% (existing batch purity), L524-0366, 99.62%. Offered by: Biosynth, AmBeed, GLPBio, TargetMol, MedChemExpress. Available pack sizes: 50mg, 0,5g, 25mg, 5mg, 1mg, 2mg, 10mg, 100mg.
[1-(3-chlorophenyl)triazol-4-yl]-thiomorpholin-4-ylmethanone (CAS 951612-19-4) is a chemical compound with the molecular formula C13H13ClN4OS and a molecular weight of 308.79 g/mol. IUPAC name: [1-(3-chlorophenyl)triazol-4-yl]-thiomorpholin-4-ylmethanone. InChIKey: ZOBDTKWDYMRKPF-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN4OS |
|---|---|
| Molecular weight | 308.79 g/mol |
| IUPAC name | [1-(3-chlorophenyl)triazol-4-yl]-thiomorpholin-4-ylmethanone |
| InChIKey | ZOBDTKWDYMRKPF-UHFFFAOYSA-N |
| SMILES | C1CSCCN1C(=O)C2=CN(N=N2)C3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)