CAS 925676-48-8 appears in our catalog under these names: Cyclopropanecarboxamide, n-[5-(3-fluoro-4-pyridinyl)-6-(3-pyridinyl)-2-pyrazinyl]-, 95%, LAS 101057, LAS101057/ 100%, LAS101057 98%, LAS101057, 99.92%. Offered by: Combi-blocks, TRC, TargetMol, Ambeed, MedChemExpress. Available pack sizes: 1g, 250mg, 100mg, 1mg, 5mg, 10mg, 25mg, 50mg.
N-[5-(3-fluoro-4-pyridinyl)-6-pyridin-3-ylpyrazin-2-yl]cyclopropanecarboxamide (CAS 925676-48-8) is a chemical compound with the molecular formula C18H14FN5O and a molecular weight of 335.3 g/mol. IUPAC name: N-[5-(3-fluoro-4-pyridinyl)-6-pyridin-3-ylpyrazin-2-yl]cyclopropanecarboxamide. InChIKey: XUYURJQIMYCWBB-UHFFFAOYSA-N.
| Molecular formula | C18H14FN5O |
|---|---|
| Molecular weight | 335.3 g/mol |
| IUPAC name | N-[5-(3-fluoro-4-pyridinyl)-6-pyridin-3-ylpyrazin-2-yl]cyclopropanecarboxamide |
| InChIKey | XUYURJQIMYCWBB-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)NC2=CN=C(C(=N2)C3=CN=CC=C3)C4=C(C=NC=C4)F |
Computed by PubChem (NCBI)