CAS 1964515-43-2 appears in our catalog under these names: LDH-IN-1/ 99.84% (existing batch purity), LDH–IN–1, LDH-IN-1 99%, LDH-IN-1, 99%, 99%, LDH-IN-1, 99.84%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
2-[5-(cyclopropylmethyl)-3-(3-phenylphenyl)-4-[(4-sulfamoylphenyl)methyl]pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid (CAS 1964515-43-2) is a chemical compound with the molecular formula C30H26N4O4S2 and a molecular weight of 570.7 g/mol. IUPAC name: 2-[5-(cyclopropylmethyl)-3-(3-phenylphenyl)-4-[(4-sulfamoylphenyl)methyl]pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid. InChIKey: ALJORCZKMBZYCR-UHFFFAOYSA-N.
| Molecular formula | C30H26N4O4S2 |
|---|---|
| Molecular weight | 570.7 g/mol |
| IUPAC name | 2-[5-(cyclopropylmethyl)-3-(3-phenylphenyl)-4-[(4-sulfamoylphenyl)methyl]pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid |
| InChIKey | ALJORCZKMBZYCR-UHFFFAOYSA-N |
| SMILES | C1CC1CC2=C(C(=NN2C3=NC(=CS3)C(=O)O)C4=CC=CC(=C4)C5=CC=CC=C5)CC6=CC=C(C=C6)S(=O)(=O)N |
Computed by PubChem (NCBI)