CAS 227010-33-5 appears in our catalog under these names: LDHA–IN–3, LDHA-IN-3/ 99.77% (existing batch purity), LDHA-IN-3, LDHA-IN-3, 99.88%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg.
1-phenylselanyl-4-(trifluoromethyl)benzene (CAS 227010-33-5) is a chemical compound with the molecular formula C13H9F3Se and a molecular weight of 301.18 g/mol. IUPAC name: 1-phenylselanyl-4-(trifluoromethyl)benzene. InChIKey: WJNWVLLRQJFFTC-UHFFFAOYSA-N.
| Molecular formula | C13H9F3Se |
|---|---|
| Molecular weight | 301.18 g/mol |
| IUPAC name | 1-phenylselanyl-4-(trifluoromethyl)benzene |
| InChIKey | WJNWVLLRQJFFTC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[Se]C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)