CAS 180908-67-2 appears in our catalog under these names: LDL-IN-3/ 99.09% (existing batch purity), LDL–IN–3, LDL-IN-3. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 20mg, 1 mg.
2,6-ditert-butyl-4-[[(4-methoxyphenyl)-dimethylsilyl]methoxy]phenol (CAS 180908-67-2) is a chemical compound with the molecular formula C24H36O3Si and a molecular weight of 400.6 g/mol. IUPAC name: 2,6-ditert-butyl-4-[[(4-methoxyphenyl)-dimethylsilyl]methoxy]phenol. InChIKey: PJKUTMONJXDZNR-UHFFFAOYSA-N.
| Molecular formula | C24H36O3Si |
|---|---|
| Molecular weight | 400.6 g/mol |
| IUPAC name | 2,6-ditert-butyl-4-[[(4-methoxyphenyl)-dimethylsilyl]methoxy]phenol |
| InChIKey | PJKUTMONJXDZNR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)OC[Si](C)(C)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)