CAS 668467-91-2 appears in our catalog under these names: LDN-57444/ 97.8% (existing batch purity), LDN 57444, LDN-57444, LDN-57444 98%, UCH-L1 Inhibitor 1PC X 10MG. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 1mg.
[(Z)-[5-chloro-1-[(2,5-dichlorophenyl)methyl]-2-oxoindol-3-ylidene]amino] acetate (CAS 668467-91-2) is a chemical compound with the molecular formula C17H11Cl3N2O3 and a molecular weight of 397.6 g/mol. IUPAC name: [(Z)-[5-chloro-1-[(2,5-dichlorophenyl)methyl]-2-oxoindol-3-ylidene]amino] acetate. InChIKey: OPQRFPHLZZPCCH-PGMHBOJBSA-N.
| Molecular formula | C17H11Cl3N2O3 |
|---|---|
| Molecular weight | 397.6 g/mol |
| IUPAC name | [(Z)-[5-chloro-1-[(2,5-dichlorophenyl)methyl]-2-oxoindol-3-ylidene]amino] acetate |
| InChIKey | OPQRFPHLZZPCCH-PGMHBOJBSA-N |
| SMILES | CC(=O)O/N=C\1/C2=C(C=CC(=C2)Cl)N(C1=O)CC3=C(C=CC(=C3)Cl)Cl |
Computed by PubChem (NCBI)