CAS 851305-26-5 appears in our catalog under these names: LJ001, LJ-001/ 98.02% (existing batch purity), LJ001 98%, LJ001, 98%, 98%, LJ001, 98.09%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10 mg.
(5Z)-5-[(5-phenylfuran-2-yl)methylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one (CAS 851305-26-5) is a chemical compound with the molecular formula C17H13NO2S2 and a molecular weight of 327.4 g/mol. IUPAC name: (5Z)-5-[(5-phenylfuran-2-yl)methylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one. InChIKey: YAIFLEPRFXXIFQ-PTNGSMBKSA-N.
| Molecular formula | C17H13NO2S2 |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | (5Z)-5-[(5-phenylfuran-2-yl)methylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| InChIKey | YAIFLEPRFXXIFQ-PTNGSMBKSA-N |
| SMILES | C=CCN1C(=O)/C(=C/C2=CC=C(O2)C3=CC=CC=C3)/SC1=S |
Computed by PubChem (NCBI)