CAS 1627710-50-2 appears in our catalog under these names: LJH685/ 98%, LJH685, LJH685, 98+%, 98+%, LJH685, 99.64%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
2,6-difluoro-4-[4-[4-(4-methylpiperazin-1-yl)phenyl]-3-pyridinyl]phenol (CAS 1627710-50-2) is a chemical compound with the molecular formula C22H21F2N3O and a molecular weight of 381.4 g/mol. IUPAC name: 2,6-difluoro-4-[4-[4-(4-methylpiperazin-1-yl)phenyl]-3-pyridinyl]phenol. InChIKey: IKUFKDGKRLMXEX-UHFFFAOYSA-N.
| Molecular formula | C22H21F2N3O |
|---|---|
| Molecular weight | 381.4 g/mol |
| IUPAC name | 2,6-difluoro-4-[4-[4-(4-methylpiperazin-1-yl)phenyl]-3-pyridinyl]phenol |
| InChIKey | IKUFKDGKRLMXEX-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC=C(C=C2)C3=C(C=NC=C3)C4=CC(=C(C(=C4)F)O)F |
Computed by PubChem (NCBI)