cas: 1418033-25-6 — see every product listed under this CAS number, including other names
LMK-235 99% (CAS 1418033-25-6) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A135784-1mg |
| cas | 1418033-25-6 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 197.94 Pln | |
| Ambeed | 5mg | 298.06 Pln | |
| Ambeed | 10mg | 437.12 Pln | |
| Ambeed | 25mg | 893.25 Pln | |
| Ambeed | 50mg | 1221.44 Pln | |
| Ambeed | 100mg | 1922.31 Pln | |
| Ambeed | 250mg | 3769.06 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A135784 |
N-[6-(hydroxyamino)-6-oxohexoxy]-3,5-dimethylbenzamide (CAS 1418033-25-6) is a chemical compound with the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. IUPAC name: N-[6-(hydroxyamino)-6-oxohexoxy]-3,5-dimethylbenzamide. InChIKey: VRYZCEONIWEUAV-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O4 |
|---|---|
| Molecular weight | 294.35 g/mol |
| IUPAC name | N-[6-(hydroxyamino)-6-oxohexoxy]-3,5-dimethylbenzamide |
| InChIKey | VRYZCEONIWEUAV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(=O)NOCCCCCC(=O)NO)C |
Computed by PubChem (NCBI)