CAS 1418033-25-6 appears in our catalog under these names: LMK235, LMK 235, LMK-235/ 97.31% (existing batch purity), LMK 235, LMK-235 99%. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 25mg, 5mg, 50mg, 100mg, 200mg, 500mg.
N-[6-(hydroxyamino)-6-oxohexoxy]-3,5-dimethylbenzamide (CAS 1418033-25-6) is a chemical compound with the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. IUPAC name: N-[6-(hydroxyamino)-6-oxohexoxy]-3,5-dimethylbenzamide. InChIKey: VRYZCEONIWEUAV-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O4 |
|---|---|
| Molecular weight | 294.35 g/mol |
| IUPAC name | N-[6-(hydroxyamino)-6-oxohexoxy]-3,5-dimethylbenzamide |
| InChIKey | VRYZCEONIWEUAV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(=O)NOCCCCCC(=O)NO)C |
Computed by PubChem (NCBI)