CAS 915412-67-8 appears in our catalog under these names: LP–261, LP-261/ 99.76% (existing batch purity), N-(3-(1H-Indol-4-yl)-5-(2-methoxypyridine-4-carbonyl)phenyl)methanesulfonamide, LP-261, LP-261, 99.94%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 10mM (in 1ml dmso), 25mg, 5mg, 50mg, 1mg, 200mg.
N-[3-(1H-indol-4-yl)-5-(2-methoxypyridine-4-carbonyl)phenyl]methanesulfonamide (CAS 915412-67-8) is a chemical compound with the molecular formula C22H19N3O4S and a molecular weight of 421.5 g/mol. IUPAC name: N-[3-(1H-indol-4-yl)-5-(2-methoxypyridine-4-carbonyl)phenyl]methanesulfonamide. InChIKey: YUVDELGTFILMBB-UHFFFAOYSA-N.
| Molecular formula | C22H19N3O4S |
|---|---|
| Molecular weight | 421.5 g/mol |
| IUPAC name | N-[3-(1H-indol-4-yl)-5-(2-methoxypyridine-4-carbonyl)phenyl]methanesulfonamide |
| InChIKey | YUVDELGTFILMBB-UHFFFAOYSA-N |
| SMILES | COC1=NC=CC(=C1)C(=O)C2=CC(=CC(=C2)C3=C4C=CNC4=CC=C3)NS(=O)(=O)C |
Computed by PubChem (NCBI)