CAS 2135600-76-7 appears in our catalog under these names: LSZ-102/ 97.84% (existing batch purity), LSZ102, LSZ–102, LSZ 102, LSZ-102. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 10mM/1mL, 50 mg, 10 mg.
(E)-3-[4-[[2-[2-(1,1-difluoroethyl)-4-fluorophenyl]-6-hydroxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid (CAS 2135600-76-7) is a chemical compound with the molecular formula C25H17F3O4S and a molecular weight of 470.5 g/mol. IUPAC name: (E)-3-[4-[[2-[2-(1,1-difluoroethyl)-4-fluorophenyl]-6-hydroxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid. InChIKey: SJXNPGGVGZXKKI-NYYWCZLTSA-N.
| Molecular formula | C25H17F3O4S |
|---|---|
| Molecular weight | 470.5 g/mol |
| IUPAC name | (E)-3-[4-[[2-[2-(1,1-difluoroethyl)-4-fluorophenyl]-6-hydroxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid |
| InChIKey | SJXNPGGVGZXKKI-NYYWCZLTSA-N |
| SMILES | CC(C1=C(C=CC(=C1)F)C2=C(C3=C(S2)C=C(C=C3)O)OC4=CC=C(C=C4)/C=C/C(=O)O)(F)F |
Computed by PubChem (NCBI)