CAS 2834106-06-6 appears in our catalog under these names: LTGO-33/ 97.6% (existing batch purity), LTGO–33, LTGO-33 99%, LTGO-33, LTGO-33, 98.83%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 50 mg.
2-(4-fluoro-2-methylphenoxy)-N-[3-(methylsulfonimidoyl)phenyl]-5-(trifluoromethyl)pyridine-3-carboxamide (CAS 2834106-06-6) is a chemical compound with the molecular formula C21H17F4N3O3S and a molecular weight of 467.4 g/mol. IUPAC name: 2-(4-fluoro-2-methylphenoxy)-N-[3-(methylsulfonimidoyl)phenyl]-5-(trifluoromethyl)pyridine-3-carboxamide. InChIKey: IIJWTXGHWFZLBF-JGCGQSQUSA-N.
| Molecular formula | C21H17F4N3O3S |
|---|---|
| Molecular weight | 467.4 g/mol |
| IUPAC name | 2-(4-fluoro-2-methylphenoxy)-N-[3-(methylsulfonimidoyl)phenyl]-5-(trifluoromethyl)pyridine-3-carboxamide |
| InChIKey | IIJWTXGHWFZLBF-JGCGQSQUSA-N |
| SMILES | CC1=C(C=CC(=C1)F)OC2=C(C=C(C=N2)C(F)(F)F)C(=O)NC3=CC(=CC=C3)[S@](=N)(=O)C |
Computed by PubChem (NCBI)