CAS 1219957-57-9 appears in our catalog under these names: LX-2761 intermediate/ 99.78% (existing batch purity), LX-2761 intermediate 98+%, 2-Amino-N-[2-(dimethylamino)ethyl]-2-methylpropanamide dihydrochloride, 98+%, 98+%, 2-Amino-N-(2-(dimethylamino)ethyl)-2-methylpropanamide dihydrochloride, 97%. Offered by: TargetMol, Ambeed, Chemat, Fluorochem. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 1g.
2-amino-N-[2-(dimethylamino)ethyl]-2-methylpropanamide;dihydrochloride (CAS 1219957-57-9) is a chemical compound with the molecular formula C8H21Cl2N3O and a molecular weight of 246.18 g/mol. IUPAC name: 2-amino-N-[2-(dimethylamino)ethyl]-2-methylpropanamide;dihydrochloride. InChIKey: LCVDMJHIUWFVFH-UHFFFAOYSA-N.
| Molecular formula | C8H21Cl2N3O |
|---|---|
| Molecular weight | 246.18 g/mol |
| IUPAC name | 2-amino-N-[2-(dimethylamino)ethyl]-2-methylpropanamide;dihydrochloride |
| InChIKey | LCVDMJHIUWFVFH-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)NCCN(C)C)N.Cl.Cl |
Computed by PubChem (NCBI)