cas: 1258861-20-9 — see every product listed under this CAS number, including other names
LY2940680, 99% (HPLC), 99% (HPLC) (CAS 1258861-20-9) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 1g, 25mg, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111OX1-10mg |
| cas | 1258861-20-9 |
| size | 10mg |
| availability | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 424.40 Pln | |
| Chemat | 1g | 7082.00 Pln | |
| Chemat | 25mg | 755.60 Pln | |
| Chemat | 50mg | 1101.20 Pln | |
| Chemat | 100mg | 1619.60 Pln | |
| Chemat | 250mg | 2867.60 Pln |
| purity | 99% (HPLC) |
|---|---|
| delivery time | 3 weeks |
4-fluoro-N-methyl-N-[1-[4-(2-methylpyrazol-3-yl)phthalazin-1-yl]piperidin-4-yl]-2-(trifluoromethyl)benzamide (CAS 1258861-20-9) is a chemical compound with the molecular formula C26H24F4N6O and a molecular weight of 512.5 g/mol. IUPAC name: 4-fluoro-N-methyl-N-[1-[4-(2-methylpyrazol-3-yl)phthalazin-1-yl]piperidin-4-yl]-2-(trifluoromethyl)benzamide. InChIKey: SZBGQDXLNMELTB-UHFFFAOYSA-N.
| Molecular formula | C26H24F4N6O |
|---|---|
| Molecular weight | 512.5 g/mol |
| IUPAC name | 4-fluoro-N-methyl-N-[1-[4-(2-methylpyrazol-3-yl)phthalazin-1-yl]piperidin-4-yl]-2-(trifluoromethyl)benzamide |
| InChIKey | SZBGQDXLNMELTB-UHFFFAOYSA-N |
| SMILES | CN1C(=CC=N1)C2=NN=C(C3=CC=CC=C32)N4CCC(CC4)N(C)C(=O)C5=C(C=C(C=C5)F)C(F)(F)F |
Computed by PubChem (NCBI)