CAS 1258861-20-9 appears in our catalog under these names: Ly2940680, 95%, Taladegib/ 99.39% (existing batch purity), LY2940680, LY 2940680, LY2940680, 99% (HPLC), 99% (HPLC). Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 100mg, 250mg, 1mg, 2mg, 5mg, 10mg, 25mg.
4-fluoro-N-methyl-N-[1-[4-(2-methylpyrazol-3-yl)phthalazin-1-yl]piperidin-4-yl]-2-(trifluoromethyl)benzamide (CAS 1258861-20-9) is a chemical compound with the molecular formula C26H24F4N6O and a molecular weight of 512.5 g/mol. IUPAC name: 4-fluoro-N-methyl-N-[1-[4-(2-methylpyrazol-3-yl)phthalazin-1-yl]piperidin-4-yl]-2-(trifluoromethyl)benzamide. InChIKey: SZBGQDXLNMELTB-UHFFFAOYSA-N.
| Molecular formula | C26H24F4N6O |
|---|---|
| Molecular weight | 512.5 g/mol |
| IUPAC name | 4-fluoro-N-methyl-N-[1-[4-(2-methylpyrazol-3-yl)phthalazin-1-yl]piperidin-4-yl]-2-(trifluoromethyl)benzamide |
| InChIKey | SZBGQDXLNMELTB-UHFFFAOYSA-N |
| SMILES | CN1C(=CC=N1)C2=NN=C(C3=CC=CC=C32)N4CCC(CC4)N(C)C(=O)C5=C(C=C(C=C5)F)C(F)(F)F |
Computed by PubChem (NCBI)