Products 425671-29-0
CAS 425671-29-0 appears in our catalog under these names: LY518674/ 99.06% (existing batch purity), LY518674, LY518674, 98.50%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 200mg.
2-methyl-2-[4-[3-[1-[(4-methylphenyl)methyl]-5-oxo-4H-1,2,4-triazol-3-yl]propyl]phenoxy]propanoic acid (CAS 425671-29-0) is a chemical compound with the molecular formula C23H27N3O4 and a molecular weight of 409.5 g/mol. IUPAC name: 2-methyl-2-[4-[3-[1-[(4-methylphenyl)methyl]-5-oxo-4H-1,2,4-triazol-3-yl]propyl]phenoxy]propanoic acid. InChIKey: PNHFDVSKDSLUFH-UHFFFAOYSA-N.
| Molecular formula | C23H27N3O4 |
|---|---|
| Molecular weight | 409.5 g/mol |
| IUPAC name | 2-methyl-2-[4-[3-[1-[(4-methylphenyl)methyl]-5-oxo-4H-1,2,4-triazol-3-yl]propyl]phenoxy]propanoic acid |
| InChIKey | PNHFDVSKDSLUFH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CN2C(=O)NC(=N2)CCCC3=CC=C(C=C3)OC(C)(C)C(=O)O |
Computed by PubChem (NCBI)