cas: 501104-16-1 — see every product listed under this CAS number, including other names
Lalistat 1, 99%, 99% (CAS 501104-16-1) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12C4QV-1mg |
| cas | 501104-16-1 |
| size | 1mg |
| availability | 0.75g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 155.60 Pln | |
| Chemat | 5mg | 242.00 Pln | |
| Chemat | 10mg | 318.80 Pln | |
| Chemat | 25mg | 554.00 Pln | |
| Chemat | 50mg | 846.80 Pln | |
| Chemat | 100mg | 1576.40 Pln | |
| Chemat | 250mg | 2642.00 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
(4-piperidin-1-yl-1,2,5-thiadiazol-3-yl) morpholine-4-carboxylate (CAS 501104-16-1) is a chemical compound with the molecular formula C12H18N4O3S and a molecular weight of 298.36 g/mol. IUPAC name: (4-piperidin-1-yl-1,2,5-thiadiazol-3-yl) morpholine-4-carboxylate. InChIKey: XAWUWPUYJUOUOF-UHFFFAOYSA-N.
| Molecular formula | C12H18N4O3S |
|---|---|
| Molecular weight | 298.36 g/mol |
| IUPAC name | (4-piperidin-1-yl-1,2,5-thiadiazol-3-yl) morpholine-4-carboxylate |
| InChIKey | XAWUWPUYJUOUOF-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=NSN=C2OC(=O)N3CCOCC3 |
Computed by PubChem (NCBI)