CAS 794554-69-1 is the registry number for 4-((4-Methylpiperazin-1-yl)sulfonyl)benzohydrazide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-(4-methylpiperazin-1-yl)sulfonylbenzohydrazide (CAS 794554-69-1) is a chemical compound with the molecular formula C12H18N4O3S and a molecular weight of 298.36 g/mol. IUPAC name: 4-(4-methylpiperazin-1-yl)sulfonylbenzohydrazide. InChIKey: JJDSGNGGVNMDFJ-UHFFFAOYSA-N.
| Molecular formula | C12H18N4O3S |
|---|---|
| Molecular weight | 298.36 g/mol |
| IUPAC name | 4-(4-methylpiperazin-1-yl)sulfonylbenzohydrazide |
| InChIKey | JJDSGNGGVNMDFJ-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)S(=O)(=O)C2=CC=C(C=C2)C(=O)NN |
Computed by PubChem (NCBI)