CAS 226904-00-3 appears in our catalog under these names: Lansoprazole sodium/ 98.35% (existing batch purity), Lansoprazole sodium, Lansoprazole sodium, Lansoprazole (sodium). Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 50mg, 1g, 10mM (in 1ml dmso), 500mg, Get quote.
Sodium 2-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfinyl]benzimidazol-1-ide (CAS 226904-00-3) is a chemical compound with the molecular formula C16H13F3N3NaO2S and a molecular weight of 391.3 g/mol. IUPAC name: sodium 2-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfinyl]benzimidazol-1-ide. InChIKey: OTGPYEHFRKGRIZ-UHFFFAOYSA-N.
| Molecular formula | C16H13F3N3NaO2S |
|---|---|
| Molecular weight | 391.3 g/mol |
| IUPAC name | sodium 2-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfinyl]benzimidazol-1-ide |
| InChIKey | OTGPYEHFRKGRIZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CN=C1CS(=O)C2=NC3=CC=CC=C3[N-]2)OCC(F)(F)F.[Na+] |
Computed by PubChem (NCBI)