Lenalidomide-I, 95%
cas: 2207541-30-6 — see every product listed under this CAS number, including other names
Lenalidomide-I, 95% (CAS 2207541-30-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g. Offered by: Ambeed, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1441561-100mg |
| cas | 2207541-30-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 259.12 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 654.06 Pln | |
| Ambeed | 5g | 2317.25 Pln | |
| Ambeed | 25g | 11211.69 Pln | |
| Fluorochem | 100mg | 263.47 Pln | |
| Fluorochem | 250mg | 372.80 Pln | |
| Fluorochem | 1g | 669.57 Pln | |
| Fluorochem | 5g | 2387.72 Pln | |
| Fluorochem | 10g | 4178.75 Pln | |
| Fluorochem | 25g | 10166.23 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3-(7-iodo-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 2207541-30-6) is a chemical compound with the molecular formula C13H11IN2O3 and a molecular weight of 370.14 g/mol. IUPAC name: 3-(7-iodo-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: BKIUJJLYXXEGFT-UHFFFAOYSA-N.
| Molecular formula | C13H11IN2O3 |
|---|---|
| Molecular weight | 370.14 g/mol |
| IUPAC name | 3-(7-iodo-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | BKIUJJLYXXEGFT-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC=C3I |
Computed by PubChem (NCBI)
Synonyms:
Lenalidomide-I, 3-(7-iodo-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione, orb1691135, (3S)-3-(4-iodo-1-oxo-isoindolin-2-yl)piperidine-2,6-dione, 3-(1,3-Dihydro-4-iodo-1-oxo-2H-isoindol-2-yl)-2,6-piperidinedione, 3-(4-iodo-1-oxo-2,3-dihydro-1H-isoindol-2-yl)piperidine-2,6-dione, 3-(7-iodanyl-3-oxidanylidene-1H-isoindol-2-yl)piperidine-2,6-dione