Products 1956310-62-5
CAS 1956310-62-5 is the registry number for Ethyl 6-hydroxy-2-(3-iodophenyl)pyrimidine-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
Ethyl 2-(3-iodophenyl)-6-oxo-1H-pyrimidine-4-carboxylate (CAS 1956310-62-5) is a chemical compound with the molecular formula C13H11IN2O3 and a molecular weight of 370.14 g/mol. IUPAC name: ethyl 2-(3-iodophenyl)-6-oxo-1H-pyrimidine-4-carboxylate. InChIKey: IMBSICZHURFHNV-UHFFFAOYSA-N.
| Molecular formula | C13H11IN2O3 |
|---|---|
| Molecular weight | 370.14 g/mol |
| IUPAC name | ethyl 2-(3-iodophenyl)-6-oxo-1H-pyrimidine-4-carboxylate |
| InChIKey | IMBSICZHURFHNV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=O)NC(=N1)C2=CC(=CC=C2)I |
Computed by PubChem (NCBI)