CAS 2750933-59-4 appears in our catalog under these names: Lepidiline C/ 98.93% (existing batch purity), Lepidiline C, 1-Benzyl-3-(3-methoxybenzyl)-4,5-dimethyl-1H-imidazol-3-ium chloride, 98%, 98%, Lepidiline C, 98.60%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 50 mg, 25 mg.
1-benzyl-3-[(3-methoxyphenyl)methyl]-4,5-dimethylimidazol-3-ium chloride (CAS 2750933-59-4) is a chemical compound with the molecular formula C20H23ClN2O and a molecular weight of 342.9 g/mol. IUPAC name: 1-benzyl-3-[(3-methoxyphenyl)methyl]-4,5-dimethylimidazol-3-ium chloride. InChIKey: GAONRCCEJWTNND-UHFFFAOYSA-M.
| Molecular formula | C20H23ClN2O |
|---|---|
| Molecular weight | 342.9 g/mol |
| IUPAC name | 1-benzyl-3-[(3-methoxyphenyl)methyl]-4,5-dimethylimidazol-3-ium chloride |
| InChIKey | GAONRCCEJWTNND-UHFFFAOYSA-M |
| SMILES | CC1=C([N+](=CN1CC2=CC=CC=C2)CC3=CC(=CC=C3)OC)C.[Cl-] |
Computed by PubChem (NCBI)