CAS 870262-90-1 appears in our catalog under these names: Letaxaban/ 99.01% (existing batch purity), Letaxaban. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1 mg, 5 mg.
1-[1-[(2S)-3-(6-chloronaphthalen-2-yl)sulfonyl-2-hydroxypropanoyl]piperidin-4-yl]-1,3-diazinan-2-one (CAS 870262-90-1) is a chemical compound with the molecular formula C22H26ClN3O5S and a molecular weight of 480.0 g/mol. IUPAC name: 1-[1-[(2S)-3-(6-chloronaphthalen-2-yl)sulfonyl-2-hydroxypropanoyl]piperidin-4-yl]-1,3-diazinan-2-one. InChIKey: GEHAEMCVKDPMKO-HXUWFJFHSA-N.
| Molecular formula | C22H26ClN3O5S |
|---|---|
| Molecular weight | 480.0 g/mol |
| IUPAC name | 1-[1-[(2S)-3-(6-chloronaphthalen-2-yl)sulfonyl-2-hydroxypropanoyl]piperidin-4-yl]-1,3-diazinan-2-one |
| InChIKey | GEHAEMCVKDPMKO-HXUWFJFHSA-N |
| SMILES | C1CNC(=O)N(C1)C2CCN(CC2)C(=O)[C@@H](CS(=O)(=O)C3=CC4=C(C=C3)C=C(C=C4)Cl)O |
Computed by PubChem (NCBI)