cas: 112809-52-6 — see every product listed under this CAS number, including other names
Letrozole related compound B 95+% (CAS 112809-52-6) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A324113-5mg |
| cas | 112809-52-6 |
| size | 5mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5mg | 631.81 Pln | |
| Ambeed | 10mg | 787.56 Pln | |
| Ambeed | 25mg | 1510.69 Pln | |
| Ambeed | 50mg | 2506.38 Pln | |
| Ambeed | 100mg | 4214.06 Pln | |
| Ambeed | 250mg | 7929.81 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A324113 |
4-[(4-cyanophenyl)-(1,2,4-triazol-4-yl)methyl]benzonitrile (CAS 112809-52-6) is a chemical compound with the molecular formula C17H11N5 and a molecular weight of 285.30 g/mol. IUPAC name: 4-[(4-cyanophenyl)-(1,2,4-triazol-4-yl)methyl]benzonitrile. InChIKey: BCTXUGAAOFIJGX-UHFFFAOYSA-N.
| Molecular formula | C17H11N5 |
|---|---|
| Molecular weight | 285.30 g/mol |
| IUPAC name | 4-[(4-cyanophenyl)-(1,2,4-triazol-4-yl)methyl]benzonitrile |
| InChIKey | BCTXUGAAOFIJGX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C(C2=CC=C(C=C2)C#N)N3C=NN=C3 |
Computed by PubChem (NCBI)