CAS 1133712-96-5 appears in our catalog under these names: Letrozole-d4, Letrozole-d4 (major), >95% (HPLC), Letrozole–d4, Letrozole-d4 (major), Letrozole-d4, 99.23%. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 500μg, 5mg, 25mg, 50mg, 1 mg.
4-[(4-cyanophenyl)-(1,2,4-triazol-1-yl)methyl]-2,3,5,6-tetradeuteriobenzonitrile (CAS 1133712-96-5) is a chemical compound with the molecular formula C17H11N5 and a molecular weight of 289.33 g/mol. IUPAC name: 4-[(4-cyanophenyl)-(1,2,4-triazol-1-yl)methyl]-2,3,5,6-tetradeuteriobenzonitrile. InChIKey: HPJKCIUCZWXJDR-NMRLXUNGSA-N.
| Molecular formula | C17H11N5 |
|---|---|
| Molecular weight | 289.33 g/mol |
| IUPAC name | 4-[(4-cyanophenyl)-(1,2,4-triazol-1-yl)methyl]-2,3,5,6-tetradeuteriobenzonitrile |
| InChIKey | HPJKCIUCZWXJDR-NMRLXUNGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C#N)[2H])[2H])C(C2=CC=C(C=C2)C#N)N3C=NC=N3)[2H] |
Computed by PubChem (NCBI)