cas: 130018-87-0 — see every product listed under this CAS number, including other names
Levocetirizine dihydrochloride, 98.00% (CAS 130018-87-0) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 50mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM75500P-10mg |
| cas | 130018-87-0 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 651.03 Pln | |
| Chemat | 50mg | 1727.26 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.00% |
| category | Chemicals |
2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetic acid;dihydrochloride (CAS 130018-87-0) is a chemical compound with the molecular formula C21H27Cl3N2O3 and a molecular weight of 461.8 g/mol. IUPAC name: 2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetic acid;dihydrochloride. InChIKey: PGLIUCLTXOYQMV-GHVWMZMZSA-N.
| Molecular formula | C21H27Cl3N2O3 |
|---|---|
| Molecular weight | 461.8 g/mol |
| IUPAC name | 2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetic acid;dihydrochloride |
| InChIKey | PGLIUCLTXOYQMV-GHVWMZMZSA-N |
| SMILES | C1CN(CCN1CCOCC(=O)O)[C@H](C2=CC=CC=C2)C3=CC=C(C=C3)Cl.Cl.Cl |
Computed by PubChem (NCBI)