CAS 130018-87-0 appears in our catalog under these names: (R)-Cetirizine DiHCl (Levocetirizine DiHCl), Levocetirizine Dihydrochloride, (R)-Cetirizine Dihydrochloride, >95% (HPLC), Levocetirizine Dihydrochloride/ 99.75% (existing batch purity), (R)–Cetirizine (hydrochloride). Offered by: Chemat Brand, Mikromol, LoGiCal, TRC, TargetMol. Available pack sizes: on request, 250mg, 10mg, 100mg, 25mg, 1g, 50mg, 200mg.
2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetic acid;dihydrochloride (CAS 130018-87-0) is a chemical compound with the molecular formula C21H27Cl3N2O3 and a molecular weight of 461.8 g/mol. IUPAC name: 2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetic acid;dihydrochloride. InChIKey: PGLIUCLTXOYQMV-GHVWMZMZSA-N.
| Molecular formula | C21H27Cl3N2O3 |
|---|---|
| Molecular weight | 461.8 g/mol |
| IUPAC name | 2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetic acid;dihydrochloride |
| InChIKey | PGLIUCLTXOYQMV-GHVWMZMZSA-N |
| SMILES | C1CN(CCN1CCOCC(=O)O)[C@H](C2=CC=CC=C2)C3=CC=C(C=C3)Cl.Cl.Cl |
Computed by PubChem (NCBI)